C45H54O6 — CID 91448130
(2S,3S,4R,5R,6R)-2-benzyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane;ethane;methoxymethane (PubChem CID 91448130) has the molecular formula C45H54O6 and a molecular weight of 690.92 g/mol. Its IUPAC name is (2S,3S,4R,5R,6R)-2-benzyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane;ethane;methoxymethane.
| Compound Name | (2S,3S,4R,5R,6R)-2-benzyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane;ethane;methoxymethane |
|---|---|
| PubChem CID | 91448130 |
| Molecular Formula | C45H54O6 |
| Molecular Weight | 690.92 g/mol |
| Exact Mass | 690.39 |
| IUPAC Name | (2S,3S,4R,5R,6R)-2-benzyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane;ethane;methoxymethane |
| SMILES | CC.COC.c1ccc(COC[C@H]2O[C@@H](Cc3ccccc3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C41H42O5.C2H6O.C2H6/c1-6-16-32(17-7-1)26-37-39(43-28-34-20-10-3-11-21-34)41(45-30-36-24-14-5-15-25-36)40(44-29-35-22-12-4-13-23-35)38(46-37)31-42-27-33-18-8-2-9-19-33;1-3-2;1-2/h1-25,37-41H,26-31H2;1-2H3;1-2H3/t37-,38+,39-,40+,41+;;/m0../s1 |
| InChIKey | JPCDMKPXBHTAIK-LFBRJHSOSA-N |
| XLogP | 9.26 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.92 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |