C38H37NO5 — CID 11478821
(E,4Z)-4-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ylidene]but-2-enenitrile (PubChem CID 11478821) has the molecular formula C38H37NO5 and a molecular weight of 587.72 g/mol. Its IUPAC name is (E,4Z)-4-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ylidene]but-2-enenitrile.
| Compound Name | (E,4Z)-4-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ylidene]but-2-enenitrile |
|---|---|
| PubChem CID | 11478821 |
| Molecular Formula | C38H37NO5 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | (E,4Z)-4-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ylidene]but-2-enenitrile |
| SMILES | N#C/C=C/C=C1\O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C38H37NO5/c39-24-14-13-23-34-36(41-26-31-17-7-2-8-18-31)38(43-28-33-21-11-4-12-22-33)37(42-27-32-19-9-3-10-20-32)35(44-34)29-40-25-30-15-5-1-6-16-30/h1-23,35-38H,25-29H2/b14-13+,34-23-/t35-,36+,37-,38-/m1/s1 |
| InChIKey | JPJPCCLGKQWQLV-ZFHLJHQGSA-N |
| XLogP | 7.32 |
| TPSA | 69.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|