C42H42O6 — CID 164669346
1-phenyl-2-[(2S,4R,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethanone (PubChem CID 164669346) has the molecular formula C42H42O6 and a molecular weight of 642.79 g/mol. Its IUPAC name is 1-phenyl-2-[(2S,4R,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethanone.
| Compound Name | 1-phenyl-2-[(2S,4R,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethanone |
|---|---|
| PubChem CID | 164669346 |
| Molecular Formula | C42H42O6 |
| Molecular Weight | 642.79 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | 1-phenyl-2-[(2S,4R,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethanone |
| SMILES | O=C(C[C@@H]1OC(COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H42O6/c43-37(36-24-14-5-15-25-36)26-38-40(45-28-33-18-8-2-9-19-33)42(47-30-35-22-12-4-13-23-35)41(46-29-34-20-10-3-11-21-34)39(48-38)31-44-27-32-16-6-1-7-17-32/h1-25,38-42H,26-31H2/t38-,39?,40?,41+,42+/m0/s1 |
| InChIKey | BSGCRVNJWIKYIN-KWTFGWKPSA-N |
| XLogP | 8.00 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.79 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |