C41H41NO6 — CID 132990345
N-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]benzamide (PubChem CID 132990345) has the molecular formula C41H41NO6 and a molecular weight of 643.78 g/mol. Its IUPAC name is N-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]benzamide.
| Compound Name | N-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]benzamide |
|---|---|
| PubChem CID | 132990345 |
| Molecular Formula | C41H41NO6 |
| Molecular Weight | 643.78 g/mol |
| Exact Mass | 643.29 |
| IUPAC Name | N-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]benzamide |
| SMILES | O=C(N[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H41NO6/c43-40(35-24-14-5-15-25-35)42-41-39(47-29-34-22-12-4-13-23-34)38(46-28-33-20-10-3-11-21-33)37(45-27-32-18-8-2-9-19-32)36(48-41)30-44-26-31-16-6-1-7-17-31/h1-25,36-39,41H,26-30H2,(H,42,43)/t36-,37+,38+,39-,41-/m1/s1 |
| InChIKey | HRJJSBTUGZYKOM-QHVMBNAHSA-N |
| XLogP | 7.11 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.78 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |