C42H44N2O6 — CID 102255225
1-benzyl-3-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]urea (PubChem CID 102255225) has the molecular formula C42H44N2O6 and a molecular weight of 672.82 g/mol. Its IUPAC name is 1-benzyl-3-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]urea.
| Compound Name | 1-benzyl-3-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]urea |
|---|---|
| PubChem CID | 102255225 |
| Molecular Formula | C42H44N2O6 |
| Molecular Weight | 672.82 g/mol |
| Exact Mass | 672.32 |
| IUPAC Name | 1-benzyl-3-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]urea |
| SMILES | O=C(NCc1ccccc1)N[C@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C42H44N2O6/c45-42(43-26-32-16-6-1-7-17-32)44-41-40(49-30-36-24-14-5-15-25-36)39(48-29-35-22-12-4-13-23-35)38(47-28-34-20-10-3-11-21-34)37(50-41)31-46-27-33-18-8-2-9-19-33/h1-25,37-41H,26-31H2,(H2,43,44,45)/t37-,38+,39+,40-,41+/m1/s1 |
| InChIKey | NKEXXASNSDKEKJ-RSGFCBGISA-N |
| XLogP | 7.18 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.82 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |