C29H32INO5 — CID 132563700
N-[(2S,3S,4S,5R,6R)-3-iodo-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetamide (PubChem CID 132563700) has the molecular formula C29H32INO5 and a molecular weight of 601.48 g/mol. Its IUPAC name is N-[(2S,3S,4S,5R,6R)-3-iodo-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetamide.
| Compound Name | N-[(2S,3S,4S,5R,6R)-3-iodo-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetamide |
|---|---|
| PubChem CID | 132563700 |
| Molecular Formula | C29H32INO5 |
| Molecular Weight | 601.48 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | N-[(2S,3S,4S,5R,6R)-3-iodo-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetamide |
| SMILES | CC(=O)N[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1I |
| InChI | InChI=1S/C29H32INO5/c1-21(32)31-29-26(30)28(35-19-24-15-9-4-10-16-24)27(34-18-23-13-7-3-8-14-23)25(36-29)20-33-17-22-11-5-2-6-12-22/h2-16,25-29H,17-20H2,1H3,(H,31,32)/t25-,26+,27-,28-,29+/m1/s1 |
| InChIKey | OCMCRNNFPPCKJQ-FOECPVOOSA-N |
| XLogP | 5.04 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|