C45H52N2O8 — CID 101354514
[2,2,5,5-tetramethyl-3-[[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]carbamoyl]pyrrol-1-yl] acetate (PubChem CID 101354514) has the molecular formula C45H52N2O8 and a molecular weight of 748.92 g/mol. Its IUPAC name is [2,2,5,5-tetramethyl-3-[[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]carbamoyl]pyrrol-1-yl] acetate.
| Compound Name | [2,2,5,5-tetramethyl-3-[[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]carbamoyl]pyrrol-1-yl] acetate |
|---|---|
| PubChem CID | 101354514 |
| Molecular Formula | C45H52N2O8 |
| Molecular Weight | 748.92 g/mol |
| Exact Mass | 748.37 |
| IUPAC Name | [2,2,5,5-tetramethyl-3-[[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]carbamoyl]pyrrol-1-yl] acetate |
| SMILES | CC(=O)ON1C(C)(C)C=C(C(=O)N[C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)C1(C)C |
| InChI | InChI=1S/C45H52N2O8/c1-32(48)55-47-44(2,3)26-37(45(47,4)5)42(49)46-43-41(53-30-36-24-16-9-17-25-36)40(52-29-35-22-14-8-15-23-35)39(51-28-34-20-12-7-13-21-34)38(54-43)31-50-27-33-18-10-6-11-19-33/h6-26,38-41,43H,27-31H2,1-5H3,(H,46,49)/t38-,39-,40+,41-,43-/m1/s1 |
| InChIKey | WAKWXBWIQPPYQV-HEMFGWNNSA-N |
| XLogP | 7.08 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.92 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |