C41H40O6 — CID 146165841
phenyl-[(2R,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanone (PubChem CID 146165841) has the molecular formula C41H40O6 and a molecular weight of 628.77 g/mol. Its IUPAC name is phenyl-[(2R,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanone.
| Compound Name | phenyl-[(2R,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanone |
|---|---|
| PubChem CID | 146165841 |
| Molecular Formula | C41H40O6 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.28 |
| IUPAC Name | phenyl-[(2R,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanone |
| SMILES | O=C(c1ccccc1)[C@@H]1OC(COCc2ccccc2)[C@@H](OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C41H40O6/c42-37(35-24-14-5-15-25-35)39-41(46-29-34-22-12-4-13-23-34)40(45-28-33-20-10-3-11-21-33)38(44-27-32-18-8-2-9-19-32)36(47-39)30-43-26-31-16-6-1-7-17-31/h1-25,36,38-41H,26-30H2/t36?,38-,39+,40?,41?/m1/s1 |
| InChIKey | DGHIUOCZMDLHGD-PYRKKTRASA-N |
| XLogP | 7.61 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |