C37H40O7 — CID 135018017
3-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoic acid (PubChem CID 135018017) has the molecular formula C37H40O7 and a molecular weight of 596.72 g/mol. Its IUPAC name is 3-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoic acid.
| Compound Name | 3-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 135018017 |
| Molecular Formula | C37H40O7 |
| Molecular Weight | 596.72 g/mol |
| Exact Mass | 596.28 |
| IUPAC Name | 3-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoic acid |
| SMILES | O=C(O)CC[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H40O7/c38-34(39)22-21-32-35(41-24-29-15-7-2-8-16-29)37(43-26-31-19-11-4-12-20-31)36(42-25-30-17-9-3-10-18-30)33(44-32)27-40-23-28-13-5-1-6-14-28/h1-20,32-33,35-37H,21-27H2,(H,38,39)/t32-,33-,35+,36-,37-/m1/s1 |
| InChIKey | SIOBNHSBZPHQRM-MTDAQLMRSA-N |
| XLogP | 6.59 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.72 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |