C30H34O7 — CID 100978536
3-[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]propanoic acid (PubChem CID 100978536) has the molecular formula C30H34O7 and a molecular weight of 506.60 g/mol. Its IUPAC name is 3-[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]propanoic acid.
| Compound Name | 3-[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 100978536 |
| Molecular Formula | C30H34O7 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 3-[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]propanoic acid |
| SMILES | CO[C@H]1O[C@H](CCC(=O)O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H34O7/c1-33-30-29(36-21-24-15-9-4-10-16-24)28(35-20-23-13-7-3-8-14-23)27(25(37-30)17-18-26(31)32)34-19-22-11-5-2-6-12-22/h2-16,25,27-30H,17-21H2,1H3,(H,31,32)/t25-,27-,28+,29+,30+/m1/s1 |
| InChIKey | SNBBUURHRONPCF-WJBPYKOESA-N |
| XLogP | 4.98 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |