C30H35NO7 — CID 90113504
N-[[(2R,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]acetamide (PubChem CID 90113504) has the molecular formula C30H35NO7 and a molecular weight of 521.61 g/mol. Its IUPAC name is N-[[(2R,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]acetamide.
| Compound Name | N-[[(2R,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]acetamide |
|---|---|
| PubChem CID | 90113504 |
| Molecular Formula | C30H35NO7 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | N-[[(2R,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]acetamide |
| SMILES | CO[C@H]1O[C@H](CONC(C)=O)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H35NO7/c1-22(32)31-37-21-26-27(34-18-23-12-6-3-7-13-23)28(35-19-24-14-8-4-9-15-24)29(30(33-2)38-26)36-20-25-16-10-5-11-17-25/h3-17,26-30H,18-21H2,1-2H3,(H,31,32)/t26-,27+,28+,29-,30+/m1/s1 |
| InChIKey | IAANBFUUCPJUMN-QBHLCAJUSA-N |
| XLogP | 4.18 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|