C25H31NO7 — CID 11155323
[(2S,3S,4S,5S,6S)-3-acetamido-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl acetate (PubChem CID 11155323) has the molecular formula C25H31NO7 and a molecular weight of 457.52 g/mol. Its IUPAC name is [(2S,3S,4S,5S,6S)-3-acetamido-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5S,6S)-3-acetamido-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11155323 |
| Molecular Formula | C25H31NO7 |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | [(2S,3S,4S,5S,6S)-3-acetamido-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl acetate |
| SMILES | CO[C@H]1O[C@H](COC(C)=O)[C@H](NC(C)=O)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C25H31NO7/c1-17(27)26-22-21(16-30-18(2)28)33-25(29-3)24(32-15-20-12-8-5-9-13-20)23(22)31-14-19-10-6-4-7-11-19/h4-13,21-25H,14-16H2,1-3H3,(H,26,27)/t21-,22+,23+,24+,25+/m1/s1 |
| InChIKey | PMPIFIBFEYVGCR-RYWAYVEBSA-N |
| XLogP | 2.60 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |