C31H32Cl3NO8 — CID 102466388
[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl N-(2,2,2-trichloroacetyl)carbamate (PubChem CID 102466388) has the molecular formula C31H32Cl3NO8 and a molecular weight of 652.96 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl N-(2,2,2-trichloroacetyl)carbamate.
| Compound Name | [(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl N-(2,2,2-trichloroacetyl)carbamate |
|---|---|
| PubChem CID | 102466388 |
| Molecular Formula | C31H32Cl3NO8 |
| Molecular Weight | 652.96 g/mol |
| Exact Mass | 651.12 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl N-(2,2,2-trichloroacetyl)carbamate |
| SMILES | CO[C@H]1O[C@H](COC(=O)NC(=O)C(Cl)(Cl)Cl)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C31H32Cl3NO8/c1-38-28-27(41-19-23-15-9-4-10-16-23)26(40-18-22-13-7-3-8-14-22)25(39-17-21-11-5-2-6-12-21)24(43-28)20-42-30(37)35-29(36)31(32,33)34/h2-16,24-28H,17-20H2,1H3,(H,35,36,37)/t24-,25-,26+,27-,28+/m1/s1 |
| InChIKey | JCGNDQKYKKFXAO-DFLSAPQXSA-N |
| XLogP | 5.74 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.96 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|