C29H41N2O8P — CID 11365196
diazanium;2-[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]ethyl-dioxido-oxo-lambda5-phosphane (PubChem CID 11365196) has the molecular formula C29H41N2O8P and a molecular weight of 576.63 g/mol. Its IUPAC name is diazanium;2-[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]ethyl-dioxido-oxo-lambda5-phosphane.
| Compound Name | diazanium;2-[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]ethyl-dioxido-oxo-lambda5-phosphane |
|---|---|
| PubChem CID | 11365196 |
| Molecular Formula | C29H41N2O8P |
| Molecular Weight | 576.63 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | diazanium;2-[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]ethyl-dioxido-oxo-lambda5-phosphane |
| SMILES | CO[C@H]1O[C@H](CCP(=O)([O-])[O-])[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1.[NH4+].[NH4+] |
| InChI | InChI=1S/C29H35O8P.2H3N/c1-33-29-28(36-21-24-15-9-4-10-16-24)27(35-20-23-13-7-3-8-14-23)26(25(37-29)17-18-38(30,31)32)34-19-22-11-5-2-6-12-22;;/h2-16,25-29H,17-21H2,1H3,(H2,30,31,32);2*1H3/t25-,26-,27+,28+,29+;;/m1../s1 |
| InChIKey | GLEGNNSCHIGZMP-HDGCMEGASA-N |
| XLogP | 4.17 |
| TPSA | 182.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.63 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|