C34H36O5Se — CID 132597287
(2S,3R,4S,5R,6S)-2-methoxy-3,4,5-tris(phenylmethoxy)-6-(phenylselanylmethyl)oxane (PubChem CID 132597287) has the molecular formula C34H36O5Se and a molecular weight of 603.62 g/mol. Its IUPAC name is (2S,3R,4S,5R,6S)-2-methoxy-3,4,5-tris(phenylmethoxy)-6-(phenylselanylmethyl)oxane.
| Compound Name | (2S,3R,4S,5R,6S)-2-methoxy-3,4,5-tris(phenylmethoxy)-6-(phenylselanylmethyl)oxane |
|---|---|
| PubChem CID | 132597287 |
| Molecular Formula | C34H36O5Se |
| Molecular Weight | 603.62 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | (2S,3R,4S,5R,6S)-2-methoxy-3,4,5-tris(phenylmethoxy)-6-(phenylselanylmethyl)oxane |
| SMILES | CO[C@H]1O[C@H](C[Se]c2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H36O5Se/c1-35-34-33(38-24-28-18-10-4-11-19-28)32(37-23-27-16-8-3-9-17-27)31(36-22-26-14-6-2-7-15-26)30(39-34)25-40-29-20-12-5-13-21-29/h2-21,30-34H,22-25H2,1H3/t30-,31+,32+,33-,34+/m1/s1 |
| InChIKey | XCBJJDRYUWOGOS-YODGASFJSA-N |
| XLogP | 5.56 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.62 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|