C61H65O13P — CID 101040386
[(2R,3R,4S,5R)-5-methoxy-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl [(2S,3S,5R,6S)-2,3,4,5,6-pentakis(phenylmethoxy)cyclohexyl] hydrogen phosphate (PubChem CID 101040386) has the molecular formula C61H65O13P and a molecular weight of 1037.15 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-methoxy-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl [(2S,3S,5R,6S)-2,3,4,5,6-pentakis(phenylmethoxy)cyclohexyl] hydrogen phosphate.
| Compound Name | [(2R,3R,4S,5R)-5-methoxy-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl [(2S,3S,5R,6S)-2,3,4,5,6-pentakis(phenylmethoxy)cyclohexyl] hydrogen phosphate |
|---|---|
| PubChem CID | 101040386 |
| Molecular Formula | C61H65O13P |
| Molecular Weight | 1037.15 g/mol |
| Exact Mass | 1036.42 |
| IUPAC Name | [(2R,3R,4S,5R)-5-methoxy-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl [(2S,3S,5R,6S)-2,3,4,5,6-pentakis(phenylmethoxy)cyclohexyl] hydrogen phosphate |
| SMILES | CO[C@@H]1O[C@H](COP(=O)(O)OC2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)C(OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C61H65O13P/c1-64-61-60(71-43-51-35-21-8-22-36-51)53(65-37-45-23-9-2-10-24-45)52(73-61)44-72-75(62,63)74-59-57(69-41-49-31-17-6-18-32-49)55(67-39-47-27-13-4-14-28-47)54(66-38-46-25-11-3-12-26-46)56(68-40-48-29-15-5-16-30-48)58(59)70-42-50-33-19-7-20-34-50/h2-36,52-61H,37-44H2,1H3,(H,62,63)/t52-,53-,54?,55-,56+,57+,58+,59?,60+,61-/m1/s1 |
| InChIKey | QNKNEGHOYOOWSO-IVIRUWGISA-N |
| XLogP | 10.97 |
| TPSA | 138.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1037.15 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|