C25H30O8 — CID 134866369
3-[(3S,6S)-4-(carboxymethyl)-6-methoxy-3,5-bis(phenylmethoxy)oxan-2-yl]propanoic acid (PubChem CID 134866369) has the molecular formula C25H30O8 and a molecular weight of 458.51 g/mol. Its IUPAC name is 3-[(3S,6S)-4-(carboxymethyl)-6-methoxy-3,5-bis(phenylmethoxy)oxan-2-yl]propanoic acid.
| Compound Name | 3-[(3S,6S)-4-(carboxymethyl)-6-methoxy-3,5-bis(phenylmethoxy)oxan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 134866369 |
| Molecular Formula | C25H30O8 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 3-[(3S,6S)-4-(carboxymethyl)-6-methoxy-3,5-bis(phenylmethoxy)oxan-2-yl]propanoic acid |
| SMILES | CO[C@H]1OC(CCC(=O)O)[C@@H](OCc2ccccc2)C(CC(=O)O)C1OCc1ccccc1 |
| InChI | InChI=1S/C25H30O8/c1-30-25-24(32-16-18-10-6-3-7-11-18)19(14-22(28)29)23(20(33-25)12-13-21(26)27)31-15-17-8-4-2-5-9-17/h2-11,19-20,23-25H,12-16H2,1H3,(H,26,27)(H,28,29)/t19?,20?,23-,24?,25-/m0/s1 |
| InChIKey | MAVLACJYJVCIQC-RRQVCGQVSA-N |
| XLogP | 3.48 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |