C14H19BrO4 — CID 14262082
2-[(2S,3S,4S,5R)-3-bromo-5-methoxy-4-phenylmethoxyoxolan-2-yl]ethanol (PubChem CID 14262082) has the molecular formula C14H19BrO4 and a molecular weight of 331.21 g/mol. Its IUPAC name is 2-[(2S,3S,4S,5R)-3-bromo-5-methoxy-4-phenylmethoxyoxolan-2-yl]ethanol.
| Compound Name | 2-[(2S,3S,4S,5R)-3-bromo-5-methoxy-4-phenylmethoxyoxolan-2-yl]ethanol |
|---|---|
| PubChem CID | 14262082 |
| Molecular Formula | C14H19BrO4 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2-[(2S,3S,4S,5R)-3-bromo-5-methoxy-4-phenylmethoxyoxolan-2-yl]ethanol |
| SMILES | CO[C@@H]1O[C@@H](CCO)[C@H](Br)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C14H19BrO4/c1-17-14-13(12(15)11(19-14)7-8-16)18-9-10-5-3-2-4-6-10/h2-6,11-14,16H,7-9H2,1H3/t11-,12-,13+,14+/m0/s1 |
| InChIKey | ZVBSRCIHLUREFT-IGQOVBAYSA-N |
| XLogP | 2.09 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|