C26H30O9 — CID 134866422
3-[(3S,6R)-3,6-bis(carboxymethyl)-4,5-bis(phenylmethoxy)oxan-2-yl]propanoic acid (PubChem CID 134866422) has the molecular formula C26H30O9 and a molecular weight of 486.52 g/mol. Its IUPAC name is 3-[(3S,6R)-3,6-bis(carboxymethyl)-4,5-bis(phenylmethoxy)oxan-2-yl]propanoic acid.
| Compound Name | 3-[(3S,6R)-3,6-bis(carboxymethyl)-4,5-bis(phenylmethoxy)oxan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 134866422 |
| Molecular Formula | C26H30O9 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 3-[(3S,6R)-3,6-bis(carboxymethyl)-4,5-bis(phenylmethoxy)oxan-2-yl]propanoic acid |
| SMILES | O=C(O)CCC1O[C@H](CC(=O)O)C(OCc2ccccc2)C(OCc2ccccc2)[C@H]1CC(=O)O |
| InChI | InChI=1S/C26H30O9/c27-22(28)12-11-20-19(13-23(29)30)25(33-15-17-7-3-1-4-8-17)26(21(35-20)14-24(31)32)34-16-18-9-5-2-6-10-18/h1-10,19-21,25-26H,11-16H2,(H,27,28)(H,29,30)(H,31,32)/t19-,20?,21+,25?,26?/m0/s1 |
| InChIKey | LBLIMNJFMOGDFV-KYGGVSLMSA-N |
| XLogP | 3.36 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |