C37H35NO9 — CID 102284389
2-[(2R,3S,4R,5R,6R)-6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetic acid (PubChem CID 102284389) has the molecular formula C37H35NO9 and a molecular weight of 637.69 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5R,6R)-6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetic acid.
| Compound Name | 2-[(2R,3S,4R,5R,6R)-6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 102284389 |
| Molecular Formula | C37H35NO9 |
| Molecular Weight | 637.69 g/mol |
| Exact Mass | 637.23 |
| IUPAC Name | 2-[(2R,3S,4R,5R,6R)-6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1O[C@H](CON2C(=O)c3ccccc3C2=O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H35NO9/c39-32(40)20-30-33(43-21-25-12-4-1-5-13-25)35(45-23-27-16-8-3-9-17-27)34(44-22-26-14-6-2-7-15-26)31(47-30)24-46-38-36(41)28-18-10-11-19-29(28)37(38)42/h1-19,30-31,33-35H,20-24H2,(H,39,40)/t30-,31-,33+,34-,35-/m1/s1 |
| InChIKey | WHLLAXYNSRCHGS-GYSSTAGKSA-N |
| XLogP | 5.21 |
| TPSA | 120.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.69 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|