C30H34O8 — CID 56935221
3-[[(2R,3R,4S,5R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]propanoic acid (PubChem CID 56935221) has the molecular formula C30H34O8 and a molecular weight of 522.59 g/mol. Its IUPAC name is 3-[[(2R,3R,4S,5R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]propanoic acid.
| Compound Name | 3-[[(2R,3R,4S,5R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]propanoic acid |
|---|---|
| PubChem CID | 56935221 |
| Molecular Formula | C30H34O8 |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 3-[[(2R,3R,4S,5R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]propanoic acid |
| SMILES | O=C(O)CCOC[C@H]1OC(O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H34O8/c31-26(32)16-17-34-21-25-27(35-18-22-10-4-1-5-11-22)28(36-19-23-12-6-2-7-13-23)29(30(33)38-25)37-20-24-14-8-3-9-15-24/h1-15,25,27-30,33H,16-21H2,(H,31,32)/t25-,27-,28+,29-,30?/m1/s1 |
| InChIKey | YCTQSNBBKUWOPC-PMPAXKATSA-N |
| XLogP | 3.95 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|