C30H34O6 — CID 11283242
(3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(prop-2-enoxymethyl)oxan-2-ol (PubChem CID 11283242) has the molecular formula C30H34O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is (3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(prop-2-enoxymethyl)oxan-2-ol.
| Compound Name | (3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(prop-2-enoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 11283242 |
| Molecular Formula | C30H34O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | (3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(prop-2-enoxymethyl)oxan-2-ol |
| SMILES | C=CCOC[C@H]1OC(O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H34O6/c1-2-18-32-22-26-27(33-19-23-12-6-3-7-13-23)28(34-20-24-14-8-4-9-15-24)29(30(31)36-26)35-21-25-16-10-5-11-17-25/h2-17,26-31H,1,18-22H2/t26-,27+,28+,29-,30?/m1/s1 |
| InChIKey | DUWRRFQRFNSQFM-LSZMOXLZSA-N |
| XLogP | 4.66 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|