C28H30O5 — CID 100977031
(3R,4R,5R,6S)-6-ethenyl-3,4,5-tris(phenylmethoxy)oxan-2-ol (PubChem CID 100977031) has the molecular formula C28H30O5 and a molecular weight of 446.54 g/mol. Its IUPAC name is (3R,4R,5R,6S)-6-ethenyl-3,4,5-tris(phenylmethoxy)oxan-2-ol.
| Compound Name | (3R,4R,5R,6S)-6-ethenyl-3,4,5-tris(phenylmethoxy)oxan-2-ol |
|---|---|
| PubChem CID | 100977031 |
| Molecular Formula | C28H30O5 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (3R,4R,5R,6S)-6-ethenyl-3,4,5-tris(phenylmethoxy)oxan-2-ol |
| SMILES | C=C[C@@H]1OC(O)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H30O5/c1-2-24-25(30-18-21-12-6-3-7-13-21)26(31-19-22-14-8-4-9-15-22)27(28(29)33-24)32-20-23-16-10-5-11-17-23/h2-17,24-29H,1,18-20H2/t24-,25+,26+,27+,28?/m0/s1 |
| InChIKey | GDSFIIGGBGOARQ-UZONRRPUSA-N |
| XLogP | 4.65 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|