C30H32O7 — CID 10940093
methyl (E)-3-[(2R,3R,4S,5R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]prop-2-enoate (PubChem CID 10940093) has the molecular formula C30H32O7 and a molecular weight of 504.58 g/mol. Its IUPAC name is methyl (E)-3-[(2R,3R,4S,5R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(2R,3R,4S,5R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10940093 |
| Molecular Formula | C30H32O7 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | methyl (E)-3-[(2R,3R,4S,5R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@H]1OC(O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H32O7/c1-33-26(31)18-17-25-27(34-19-22-11-5-2-6-12-22)28(35-20-23-13-7-3-8-14-23)29(30(32)37-25)36-21-24-15-9-4-10-16-24/h2-18,25,27-30,32H,19-21H2,1H3/b18-17+/t25-,27-,28+,29-,30?/m1/s1 |
| InChIKey | CZFYRAZCBXOVIO-CBVJIZDBSA-N |
| XLogP | 4.19 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|