C38H40O8 — CID 100933134
methyl (E)-3-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyprop-2-enoate (PubChem CID 100933134) has the molecular formula C38H40O8 and a molecular weight of 624.73 g/mol. Its IUPAC name is methyl (E)-3-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyprop-2-enoate.
| Compound Name | methyl (E)-3-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyprop-2-enoate |
|---|---|
| PubChem CID | 100933134 |
| Molecular Formula | C38H40O8 |
| Molecular Weight | 624.73 g/mol |
| Exact Mass | 624.27 |
| IUPAC Name | methyl (E)-3-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyprop-2-enoate |
| SMILES | COC(=O)/C=C/OC1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C38H40O8/c1-40-34(39)22-23-42-38-37(45-27-32-20-12-5-13-21-32)36(44-26-31-18-10-4-11-19-31)35(43-25-30-16-8-3-9-17-30)33(46-38)28-41-24-29-14-6-2-7-15-29/h2-23,33,35-38H,24-28H2,1H3/b23-22+/t33-,35-,36+,37-,38?/m1/s1 |
| InChIKey | GWAAFRGVZVQHMQ-VYMFZJBPSA-N |
| XLogP | 6.39 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.73 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|