C14H16O6S — CID 10380794
methyl (E)-3-[(4S,5S)-2-oxo-5-(phenylmethoxymethyl)-1,3,2-dioxathiolan-4-yl]prop-2-enoate (PubChem CID 10380794) has the molecular formula C14H16O6S and a molecular weight of 312.34 g/mol. Its IUPAC name is methyl (E)-3-[(4S,5S)-2-oxo-5-(phenylmethoxymethyl)-1,3,2-dioxathiolan-4-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(4S,5S)-2-oxo-5-(phenylmethoxymethyl)-1,3,2-dioxathiolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10380794 |
| Molecular Formula | C14H16O6S |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | methyl (E)-3-[(4S,5S)-2-oxo-5-(phenylmethoxymethyl)-1,3,2-dioxathiolan-4-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H]1OS(=O)O[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C14H16O6S/c1-17-14(15)8-7-12-13(20-21(16)19-12)10-18-9-11-5-3-2-4-6-11/h2-8,12-13H,9-10H2,1H3/b8-7+/t12-,13-,21?/m0/s1 |
| InChIKey | PKIZQHUPTDHQBO-LRWGZDJKSA-N |
| XLogP | 1.30 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|