C15H17NO5 — CID 175544203
methyl 3-[2-(phenylmethoxycarbonylamino)oxetan-3-yl]prop-2-enoate (PubChem CID 175544203) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is methyl 3-[2-(phenylmethoxycarbonylamino)oxetan-3-yl]prop-2-enoate.
| Compound Name | methyl 3-[2-(phenylmethoxycarbonylamino)oxetan-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 175544203 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | methyl 3-[2-(phenylmethoxycarbonylamino)oxetan-3-yl]prop-2-enoate |
| SMILES | COC(=O)C=CC1COC1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H17NO5/c1-19-13(17)8-7-12-10-20-14(12)16-15(18)21-9-11-5-3-2-4-6-11/h2-8,12,14H,9-10H2,1H3,(H,16,18) |
| InChIKey | DVYNDYKCNAQZIK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|