C21H29NO4 — CID 67722160
tert-butyl (E)-3-[4-(phenylmethoxycarbonylamino)cyclohexyl]prop-2-enoate (PubChem CID 67722160) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is tert-butyl (E)-3-[4-(phenylmethoxycarbonylamino)cyclohexyl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[4-(phenylmethoxycarbonylamino)cyclohexyl]prop-2-enoate |
|---|---|
| PubChem CID | 67722160 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | tert-butyl (E)-3-[4-(phenylmethoxycarbonylamino)cyclohexyl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/C1CCC(NC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H29NO4/c1-21(2,3)26-19(23)14-11-16-9-12-18(13-10-16)22-20(24)25-15-17-7-5-4-6-8-17/h4-8,11,14,16,18H,9-10,12-13,15H2,1-3H3,(H,22,24)/b14-11+ |
| InChIKey | VQKIGRMFIBSVAS-SDNWHVSQSA-N |
| XLogP | 4.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|