C49H48O7 — CID 163468376
[2-[(4-methoxyphenyl)methyl]phenyl]-[(2R,3R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanone (PubChem CID 163468376) has the molecular formula C49H48O7 and a molecular weight of 748.92 g/mol. Its IUPAC name is [2-[(4-methoxyphenyl)methyl]phenyl]-[(2R,3R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanone.
| Compound Name | [2-[(4-methoxyphenyl)methyl]phenyl]-[(2R,3R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanone |
|---|---|
| PubChem CID | 163468376 |
| Molecular Formula | C49H48O7 |
| Molecular Weight | 748.92 g/mol |
| Exact Mass | 748.34 |
| IUPAC Name | [2-[(4-methoxyphenyl)methyl]phenyl]-[(2R,3R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanone |
| SMILES | COc1ccc(Cc2ccccc2C(=O)[C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C49H48O7/c1-51-42-28-26-36(27-29-42)30-41-24-14-15-25-43(41)45(50)47-49(55-34-40-22-12-5-13-23-40)48(54-33-39-20-10-4-11-21-39)46(53-32-38-18-8-3-9-19-38)44(56-47)35-52-31-37-16-6-2-7-17-37/h2-29,44,46-49H,30-35H2,1H3/t44-,46-,47+,48?,49?/m1/s1 |
| InChIKey | BUNPMEPUTGEQNN-PWYVFOOOSA-N |
| XLogP | 9.21 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.92 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |