C28H30O5 — CID 53483097
(2R,4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carbaldehyde (PubChem CID 53483097) has the molecular formula C28H30O5 and a molecular weight of 446.54 g/mol. Its IUPAC name is (2R,4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carbaldehyde.
| Compound Name | (2R,4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carbaldehyde |
|---|---|
| PubChem CID | 53483097 |
| Molecular Formula | C28H30O5 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (2R,4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carbaldehyde |
| SMILES | O=C[C@H]1C[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C28H30O5/c29-17-25-16-26(31-19-23-12-6-2-7-13-23)28(32-20-24-14-8-3-9-15-24)27(33-25)21-30-18-22-10-4-1-5-11-22/h1-15,17,25-28H,16,18-21H2/t25-,26-,27-,28+/m1/s1 |
| InChIKey | ZBZYPJHJWLRKHH-HPQIJTKRSA-N |
| XLogP | 4.73 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|