C33H34O4S — CID 126612117
(4R,6S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-phenylsulfanyloxane (PubChem CID 126612117) has the molecular formula C33H34O4S and a molecular weight of 526.70 g/mol. Its IUPAC name is (4R,6S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-phenylsulfanyloxane.
| Compound Name | (4R,6S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-phenylsulfanyloxane |
|---|---|
| PubChem CID | 126612117 |
| Molecular Formula | C33H34O4S |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | (4R,6S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-phenylsulfanyloxane |
| SMILES | c1ccc(COCC2O[C@@H](Sc3ccccc3)C[C@@H](OCc3ccccc3)C2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H34O4S/c1-5-13-26(14-6-1)22-34-25-31-33(36-24-28-17-9-3-10-18-28)30(35-23-27-15-7-2-8-16-27)21-32(37-31)38-29-19-11-4-12-20-29/h1-20,30-33H,21-25H2/t30-,31?,32+,33?/m1/s1 |
| InChIKey | GPFKOEZZNFMLHO-DAZIZQLOSA-N |
| XLogP | 7.28 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |