C30H34O4S — CID 11511510
(2R,3S,4R)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-prop-2-enylsulfanyloxane (PubChem CID 11511510) has the molecular formula C30H34O4S and a molecular weight of 490.67 g/mol. Its IUPAC name is (2R,3S,4R)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-prop-2-enylsulfanyloxane.
| Compound Name | (2R,3S,4R)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-prop-2-enylsulfanyloxane |
|---|---|
| PubChem CID | 11511510 |
| Molecular Formula | C30H34O4S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | (2R,3S,4R)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-prop-2-enylsulfanyloxane |
| SMILES | C=CCSC1C[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C30H34O4S/c1-2-18-35-29-19-27(32-21-25-14-8-4-9-15-25)30(33-22-26-16-10-5-11-17-26)28(34-29)23-31-20-24-12-6-3-7-13-24/h2-17,27-30H,1,18-23H2/t27-,28-,29?,30+/m1/s1 |
| InChIKey | DGSSWNSIJHJTKM-XUCOSLSWSA-N |
| XLogP | 6.41 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|