C36H40O7S — CID 101169404
(2R,3R,4S,5R,6R)-2-ethylsulfonyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 101169404) has the molecular formula C36H40O7S and a molecular weight of 616.78 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-ethylsulfonyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,3R,4S,5R,6R)-2-ethylsulfonyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 101169404 |
| Molecular Formula | C36H40O7S |
| Molecular Weight | 616.78 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-ethylsulfonyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | CCS(=O)(=O)[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H40O7S/c1-2-44(37,38)36-35(42-26-31-21-13-6-14-22-31)34(41-25-30-19-11-5-12-20-30)33(40-24-29-17-9-4-10-18-29)32(43-36)27-39-23-28-15-7-3-8-16-28/h3-22,32-36H,2,23-27H2,1H3/t32-,33-,34+,35-,36-/m1/s1 |
| InChIKey | HVYSCYOATHZPDK-SQGINLDNSA-N |
| XLogP | 6.12 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.78 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |