C39H39NO7S — CID 72749768
2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]sulfonylpyridine (PubChem CID 72749768) has the molecular formula C39H39NO7S and a molecular weight of 665.81 g/mol. Its IUPAC name is 2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]sulfonylpyridine.
| Compound Name | 2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]sulfonylpyridine |
|---|---|
| PubChem CID | 72749768 |
| Molecular Formula | C39H39NO7S |
| Molecular Weight | 665.81 g/mol |
| Exact Mass | 665.24 |
| IUPAC Name | 2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]sulfonylpyridine |
| SMILES | O=S(=O)(c1ccccn1)C1OC(COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C39H39NO7S/c41-48(42,35-23-13-14-24-40-35)39-38(46-28-33-21-11-4-12-22-33)37(45-27-32-19-9-3-10-20-32)36(44-26-31-17-7-2-8-18-31)34(47-39)29-43-25-30-15-5-1-6-16-30/h1-24,34,36-39H,25-29H2 |
| InChIKey | MGKNLYNEULNGFT-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.81 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |