C40H39F2NO8S — CID 122226659
(2R,3R,4S,5S,6R)-2-[difluoro(pyridin-2-ylsulfonyl)methyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol (PubChem CID 122226659) has the molecular formula C40H39F2NO8S and a molecular weight of 731.81 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[difluoro(pyridin-2-ylsulfonyl)methyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[difluoro(pyridin-2-ylsulfonyl)methyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 122226659 |
| Molecular Formula | C40H39F2NO8S |
| Molecular Weight | 731.81 g/mol |
| Exact Mass | 731.24 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[difluoro(pyridin-2-ylsulfonyl)methyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
| SMILES | O=S(=O)(c1ccccn1)C(F)(F)[C@]1(O)O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C40H39F2NO8S/c41-40(42,52(45,46)35-23-13-14-24-43-35)39(44)38(50-28-33-21-11-4-12-22-33)37(49-27-32-19-9-3-10-20-32)36(48-26-31-17-7-2-8-18-31)34(51-39)29-47-25-30-15-5-1-6-16-30/h1-24,34,36-38,44H,25-29H2/t34-,36+,37+,38-,39-/m1/s1 |
| InChIKey | QYCWUMYFSHDOPE-GNIJVRCISA-N |
| XLogP | 6.51 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.81 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |