C36H38O8 — CID 54345731
2-[(3R,4S,5S,6R)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetic acid (PubChem CID 54345731) has the molecular formula C36H38O8 and a molecular weight of 598.69 g/mol. Its IUPAC name is 2-[(3R,4S,5S,6R)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetic acid.
| Compound Name | 2-[(3R,4S,5S,6R)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 54345731 |
| Molecular Formula | C36H38O8 |
| Molecular Weight | 598.69 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | 2-[(3R,4S,5S,6R)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetic acid |
| SMILES | O=C(O)CC1(O)O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H38O8/c37-32(38)21-36(39)35(43-25-30-19-11-4-12-20-30)34(42-24-29-17-9-3-10-18-29)33(41-23-28-15-7-2-8-16-28)31(44-36)26-40-22-27-13-5-1-6-14-27/h1-20,31,33-35,39H,21-26H2,(H,37,38)/t31-,33+,34+,35-,36?/m1/s1 |
| InChIKey | UCEOTRLQCKMRDD-SCSBQZQXSA-N |
| XLogP | 5.52 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.69 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |