C41H46O8 — CID 101190988
ethyl 2-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxan-2-yl]acetate (PubChem CID 101190988) has the molecular formula C41H46O8 and a molecular weight of 666.81 g/mol. Its IUPAC name is ethyl 2-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxan-2-yl]acetate.
| Compound Name | ethyl 2-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxan-2-yl]acetate |
|---|---|
| PubChem CID | 101190988 |
| Molecular Formula | C41H46O8 |
| Molecular Weight | 666.81 g/mol |
| Exact Mass | 666.32 |
| IUPAC Name | ethyl 2-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxan-2-yl]acetate |
| SMILES | C=CCO[C@@]1(CC(=O)OCC)O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H46O8/c1-3-25-48-41(26-37(42)44-4-2)40(47-30-35-23-15-8-16-24-35)39(46-29-34-21-13-7-14-22-34)38(45-28-33-19-11-6-12-20-33)36(49-41)31-43-27-32-17-9-5-10-18-32/h3,5-24,36,38-40H,1,4,25-31H2,2H3/t36-,38+,39+,40-,41+/m1/s1 |
| InChIKey | FQPQVIZUDXESAK-XBELVZINSA-N |
| XLogP | 7.21 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.81 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|