C39H42O7 — CID 23656418
[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl] acetate (PubChem CID 23656418) has the molecular formula C39H42O7 and a molecular weight of 622.76 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl] acetate |
|---|---|
| PubChem CID | 23656418 |
| Molecular Formula | C39H42O7 |
| Molecular Weight | 622.76 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl] acetate |
| SMILES | C=CC[C@]1(OC(C)=O)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C39H42O7/c1-3-24-39(45-30(2)40)38(44-28-34-22-14-7-15-23-34)37(43-27-33-20-12-6-13-21-33)36(42-26-32-18-10-5-11-19-32)35(46-39)29-41-25-31-16-8-4-9-17-31/h3-23,35-38H,1,24-29H2,2H3/t35-,36-,37+,38-,39+/m1/s1 |
| InChIKey | ZXWLDDSRHCMMKK-QGVRFUEOSA-N |
| XLogP | 7.19 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.76 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|