C40H44O5 — CID 11422071
(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2,2-bis(prop-2-enyl)oxane (PubChem CID 11422071) has the molecular formula C40H44O5 and a molecular weight of 604.79 g/mol. Its IUPAC name is (3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2,2-bis(prop-2-enyl)oxane.
| Compound Name | (3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2,2-bis(prop-2-enyl)oxane |
|---|---|
| PubChem CID | 11422071 |
| Molecular Formula | C40H44O5 |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 604.32 |
| IUPAC Name | (3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2,2-bis(prop-2-enyl)oxane |
| SMILES | C=CCC1(CC=C)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C40H44O5/c1-3-25-40(26-4-2)39(44-30-35-23-15-8-16-24-35)38(43-29-34-21-13-7-14-22-34)37(42-28-33-19-11-6-12-20-33)36(45-40)31-41-27-32-17-9-5-10-18-32/h3-24,36-39H,1-2,25-31H2/t36-,37-,38+,39-/m1/s1 |
| InChIKey | YIZSTOYRUSKMFY-ZBMOXSJNSA-N |
| XLogP | 8.25 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|