C46H56O11 — CID 146029712
(2S,4S,5S)-2-ethenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-[[(3S,4S,6R)-3,4,5,6-tetramethoxyoxan-2-yl]methoxy]oxane (PubChem CID 146029712) has the molecular formula C46H56O11 and a molecular weight of 784.94 g/mol. Its IUPAC name is (2S,4S,5S)-2-ethenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-[[(3S,4S,6R)-3,4,5,6-tetramethoxyoxan-2-yl]methoxy]oxane.
| Compound Name | (2S,4S,5S)-2-ethenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-[[(3S,4S,6R)-3,4,5,6-tetramethoxyoxan-2-yl]methoxy]oxane |
|---|---|
| PubChem CID | 146029712 |
| Molecular Formula | C46H56O11 |
| Molecular Weight | 784.94 g/mol |
| Exact Mass | 784.38 |
| IUPAC Name | (2S,4S,5S)-2-ethenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-[[(3S,4S,6R)-3,4,5,6-tetramethoxyoxan-2-yl]methoxy]oxane |
| SMILES | C=C[C@]1(OCC2O[C@@H](OC)C(OC)[C@@H](OC)[C@H]2OC)OC(COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C46H56O11/c1-6-46(55-32-37-39(47-2)41(48-3)43(49-4)45(50-5)56-37)44(54-30-36-25-17-10-18-26-36)42(53-29-35-23-15-9-16-24-35)40(52-28-34-21-13-8-14-22-34)38(57-46)31-51-27-33-19-11-7-12-20-33/h6-26,37-45H,1,27-32H2,2-5H3/t37?,38?,39-,40-,41-,42-,43?,44?,45+,46-/m0/s1 |
| InChIKey | PTJIRFINUVRSHN-QOLUDSEZSA-N |
| XLogP | 6.67 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.94 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|