C38H40O8 — CID 10985025
2-[(2S,3R,4S,5R,6R)-2-ethenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyacetic acid (PubChem CID 10985025) has the molecular formula C38H40O8 and a molecular weight of 624.73 g/mol. Its IUPAC name is 2-[(2S,3R,4S,5R,6R)-2-ethenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyacetic acid.
| Compound Name | 2-[(2S,3R,4S,5R,6R)-2-ethenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyacetic acid |
|---|---|
| PubChem CID | 10985025 |
| Molecular Formula | C38H40O8 |
| Molecular Weight | 624.73 g/mol |
| Exact Mass | 624.27 |
| IUPAC Name | 2-[(2S,3R,4S,5R,6R)-2-ethenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyacetic acid |
| SMILES | C=C[C@]1(OCC(=O)O)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C38H40O8/c1-2-38(45-28-34(39)40)37(44-26-32-21-13-6-14-22-32)36(43-25-31-19-11-5-12-20-31)35(42-24-30-17-9-4-10-18-30)33(46-38)27-41-23-29-15-7-3-8-16-29/h2-22,33,35-37H,1,23-28H2,(H,39,40)/t33-,35-,36+,37-,38+/m1/s1 |
| InChIKey | GJKICHUGCPGBIR-KFHNNOKBSA-N |
| XLogP | 6.34 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.73 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|