C28H30O6 — CID 51350664
(3R,4S,5S)-2-methoxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane-2-carbaldehyde (PubChem CID 51350664) has the molecular formula C28H30O6 and a molecular weight of 462.54 g/mol. Its IUPAC name is (3R,4S,5S)-2-methoxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane-2-carbaldehyde.
| Compound Name | (3R,4S,5S)-2-methoxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 51350664 |
| Molecular Formula | C28H30O6 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | (3R,4S,5S)-2-methoxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane-2-carbaldehyde |
| SMILES | COC1(C=O)O[C@@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H30O6/c1-30-28(21-29)27(33-19-24-15-9-4-10-16-24)26(32-18-23-13-7-3-8-14-23)25(34-28)20-31-17-22-11-5-2-6-12-22/h2-16,21,25-27H,17-20H2,1H3/t25-,26-,27+,28?/m0/s1 |
| InChIKey | MYVZFJVFEUYHNU-JWHBBQGKSA-N |
| XLogP | 4.31 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|