C42H48O6 — CID 146029719
(2S,4S,5S)-2-cyclohexyloxy-2-ethenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 146029719) has the molecular formula C42H48O6 and a molecular weight of 648.84 g/mol. Its IUPAC name is (2S,4S,5S)-2-cyclohexyloxy-2-ethenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,4S,5S)-2-cyclohexyloxy-2-ethenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 146029719 |
| Molecular Formula | C42H48O6 |
| Molecular Weight | 648.84 g/mol |
| Exact Mass | 648.35 |
| IUPAC Name | (2S,4S,5S)-2-cyclohexyloxy-2-ethenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | C=C[C@]1(OC2CCCCC2)OC(COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C42H48O6/c1-2-42(47-37-26-16-7-17-27-37)41(46-31-36-24-14-6-15-25-36)40(45-30-35-22-12-5-13-23-35)39(44-29-34-20-10-4-11-21-34)38(48-42)32-43-28-33-18-8-3-9-19-33/h2-6,8-15,18-25,37-41H,1,7,16-17,26-32H2/t38?,39-,40-,41?,42-/m0/s1 |
| InChIKey | IIAYBXVEYSBJBP-HQAUXCTISA-N |
| XLogP | 8.59 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.84 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|