C55H55NO10 — CID 58666439
methyl 3-[(2S,4R,5S)-2-ethenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 58666439) has the molecular formula C55H55NO10 and a molecular weight of 890.04 g/mol. Its IUPAC name is methyl 3-[(2S,4R,5S)-2-ethenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | methyl 3-[(2S,4R,5S)-2-ethenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 58666439 |
| Molecular Formula | C55H55NO10 |
| Molecular Weight | 890.04 g/mol |
| Exact Mass | 889.38 |
| IUPAC Name | methyl 3-[(2S,4R,5S)-2-ethenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | C=C[C@]1(OCC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)OC)OC(COCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C55H55NO10/c1-3-55(65-37-48(53(57)59-2)56-54(58)64-36-47-45-30-18-16-28-43(45)44-29-17-19-31-46(44)47)52(63-35-42-26-14-7-15-27-42)51(62-34-41-24-12-6-13-25-41)50(61-33-40-22-10-5-11-23-40)49(66-55)38-60-32-39-20-8-4-9-21-39/h3-31,47-52H,1,32-38H2,2H3,(H,56,58)/t48?,49?,50-,51+,52?,55-/m0/s1 |
| InChIKey | AWNDYNFVKYDHEB-UNJSLQHISA-N |
| XLogP | 9.34 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.04 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|