C40H44O8 — CID 91158984
methyl (2S)-2-hydroxy-2-[(2S,4S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl]acetate (PubChem CID 91158984) has the molecular formula C40H44O8 and a molecular weight of 652.78 g/mol. Its IUPAC name is methyl (2S)-2-hydroxy-2-[(2S,4S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl]acetate.
| Compound Name | methyl (2S)-2-hydroxy-2-[(2S,4S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 91158984 |
| Molecular Formula | C40H44O8 |
| Molecular Weight | 652.78 g/mol |
| Exact Mass | 652.30 |
| IUPAC Name | methyl (2S)-2-hydroxy-2-[(2S,4S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl]acetate |
| SMILES | C=CC[C@@]1([C@H](O)C(=O)OC)OC(COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C40H44O8/c1-3-24-40(37(41)39(42)43-2)38(47-28-33-22-14-7-15-23-33)36(46-27-32-20-12-6-13-21-32)35(45-26-31-18-10-5-11-19-31)34(48-40)29-44-25-30-16-8-4-9-17-30/h3-23,34-38,41H,1,24-29H2,2H3/t34?,35-,36+,37-,38?,40+/m1/s1 |
| InChIKey | ZXLIKRXSBOWSJZ-PXYCWCBSSA-N |
| XLogP | 6.21 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.78 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|