C39H42O8 — CID 87530760
2-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl]ethaneperoxoic acid (PubChem CID 87530760) has the molecular formula C39H42O8 and a molecular weight of 638.76 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl]ethaneperoxoic acid.
| Compound Name | 2-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl]ethaneperoxoic acid |
|---|---|
| PubChem CID | 87530760 |
| Molecular Formula | C39H42O8 |
| Molecular Weight | 638.76 g/mol |
| Exact Mass | 638.29 |
| IUPAC Name | 2-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl]ethaneperoxoic acid |
| SMILES | C=CC[C@]1(CC(=O)OO)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C39H42O8/c1-2-23-39(24-35(40)47-41)38(45-28-33-21-13-6-14-22-33)37(44-27-32-19-11-5-12-20-32)36(43-26-31-17-9-4-10-18-31)34(46-39)29-42-25-30-15-7-3-8-16-30/h2-22,34,36-38,41H,1,23-29H2/t34-,36-,37+,38+,39-/m1/s1 |
| InChIKey | DIEJJLQWWDIKJA-JXMWNMMWSA-N |
| XLogP | 7.08 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.76 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|