C41H45NO6 — CID 50924205
N-[[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl]methyl]prop-2-enamide (PubChem CID 50924205) has the molecular formula C41H45NO6 and a molecular weight of 647.81 g/mol. Its IUPAC name is N-[[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl]methyl]prop-2-enamide.
| Compound Name | N-[[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 50924205 |
| Molecular Formula | C41H45NO6 |
| Molecular Weight | 647.81 g/mol |
| Exact Mass | 647.32 |
| IUPAC Name | N-[[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl]methyl]prop-2-enamide |
| SMILES | C=CC[C@]1(CNC(=O)C=C)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H45NO6/c1-3-25-41(31-42-37(43)4-2)40(47-29-35-23-15-8-16-24-35)39(46-28-34-21-13-7-14-22-34)38(45-27-33-19-11-6-12-20-33)36(48-41)30-44-26-32-17-9-5-10-18-32/h3-24,36,38-40H,1-2,25-31H2,(H,42,43)/t36-,38-,39+,40-,41-/m1/s1 |
| InChIKey | GXZPRQKJCCJRDX-HXBMFNGISA-N |
| XLogP | 6.98 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.81 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|