C49H52N2O11 — CID 10629367
tert-butyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2S,3R,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropanoate (PubChem CID 10629367) has the molecular formula C49H52N2O11 and a molecular weight of 844.96 g/mol. Its IUPAC name is tert-butyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2S,3R,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropanoate.
| Compound Name | tert-butyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2S,3R,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropanoate |
|---|---|
| PubChem CID | 10629367 |
| Molecular Formula | C49H52N2O11 |
| Molecular Weight | 844.96 g/mol |
| Exact Mass | 844.36 |
| IUPAC Name | tert-butyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2S,3R,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](CO[C@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1[N+](=O)[O-])NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C49H52N2O11/c1-49(2,3)62-46(52)41(50-48(53)60-30-40-38-25-15-13-23-36(38)37-24-14-16-26-39(37)40)31-59-47-43(51(54)55)45(58-29-35-21-11-6-12-22-35)44(57-28-34-19-9-5-10-20-34)42(61-47)32-56-27-33-17-7-4-8-18-33/h4-26,40-45,47H,27-32H2,1-3H3,(H,50,53)/t41-,42-,43-,44+,45-,47+/m1/s1 |
| InChIKey | BVOSZBAXYABTSD-NDIDFWBKSA-N |
| XLogP | 8.01 |
| TPSA | 153.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.96 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|