C31H35NO9 — CID 101422422
methyl (2R)-2-hydroxy-3-[(2S,3S,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoate (PubChem CID 101422422) has the molecular formula C31H35NO9 and a molecular weight of 565.62 g/mol. Its IUPAC name is methyl (2R)-2-hydroxy-3-[(2S,3S,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoate.
| Compound Name | methyl (2R)-2-hydroxy-3-[(2S,3S,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoate |
|---|---|
| PubChem CID | 101422422 |
| Molecular Formula | C31H35NO9 |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | methyl (2R)-2-hydroxy-3-[(2S,3S,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoate |
| SMILES | COC(=O)[C@H](O)C[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C31H35NO9/c1-37-31(34)25(33)17-26-28(32(35)36)30(40-20-24-15-9-4-10-16-24)29(39-19-23-13-7-3-8-14-23)27(41-26)21-38-18-22-11-5-2-6-12-22/h2-16,25-30,33H,17-21H2,1H3/t25-,26+,27-,28+,29+,30-/m1/s1 |
| InChIKey | UGNXGWFGDCAWPH-YPIBMZQWSA-N |
| XLogP | 3.71 |
| TPSA | 126.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|