C37H46N2O11 — CID 46868621
methyl (2S)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(2S,3R,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropanoate (PubChem CID 46868621) has the molecular formula C37H46N2O11 and a molecular weight of 694.78 g/mol. Its IUPAC name is methyl (2S)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(2S,3R,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropanoate.
| Compound Name | methyl (2S)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(2S,3R,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropanoate |
|---|---|
| PubChem CID | 46868621 |
| Molecular Formula | C37H46N2O11 |
| Molecular Weight | 694.78 g/mol |
| Exact Mass | 694.31 |
| IUPAC Name | methyl (2S)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(2S,3R,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropanoate |
| SMILES | COC(=O)[C@](C)(CO[C@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1[N+](=O)[O-])NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H46N2O11/c1-36(2,3)50-35(41)38-37(4,34(40)44-5)25-48-33-30(39(42)43)32(47-23-28-19-13-8-14-20-28)31(46-22-27-17-11-7-12-18-27)29(49-33)24-45-21-26-15-9-6-10-16-26/h6-20,29-33H,21-25H2,1-5H3,(H,38,41)/t29-,30-,31+,32-,33+,37+/m1/s1 |
| InChIKey | ZRMGTSZNLGIHOC-LKEQZNBESA-N |
| XLogP | 5.22 |
| TPSA | 153.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.78 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|